C17H21NO5S — CID 8673470
[2-(N-[(3R)-1,1-dioxothiolan-3-yl]anilino)-2-oxoethyl] (E)-pent-2-enoate (PubChem CID 8673470) has the molecular formula C17H21NO5S and a molecular weight of 351.42 g/mol. Its IUPAC name is [2-(N-[(3R)-1,1-dioxothiolan-3-yl]anilino)-2-oxoethyl] (E)-pent-2-enoate.
| Compound Name | [2-(N-[(3R)-1,1-dioxothiolan-3-yl]anilino)-2-oxoethyl] (E)-pent-2-enoate |
|---|---|
| PubChem CID | 8673470 |
| Molecular Formula | C17H21NO5S |
| Molecular Weight | 351.42 g/mol |
| Exact Mass | 351.11 |
| IUPAC Name | [2-(N-[(3R)-1,1-dioxothiolan-3-yl]anilino)-2-oxoethyl] (E)-pent-2-enoate |
| SMILES | CC/C=C/C(=O)OCC(=O)N(c1ccccc1)[C@@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C17H21NO5S/c1-2-3-9-17(20)23-12-16(19)18(14-7-5-4-6-8-14)15-10-11-24(21,22)13-15/h3-9,15H,2,10-13H2,1H3/b9-3+/t15-/m1/s1 |
| InChIKey | RYPVRHRUFWALCE-RUGXIKGKSA-N |
| XLogP | 1.72 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.42 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|