C22H23NO5S — CID 7849511
[2-(N-[(3R)-1,1-dioxothiolan-3-yl]anilino)-2-oxoethyl] (E)-3-(2-methylphenyl)prop-2-enoate (PubChem CID 7849511) has the molecular formula C22H23NO5S and a molecular weight of 413.50 g/mol. Its IUPAC name is [2-(N-[(3R)-1,1-dioxothiolan-3-yl]anilino)-2-oxoethyl] (E)-3-(2-methylphenyl)prop-2-enoate.
| Compound Name | [2-(N-[(3R)-1,1-dioxothiolan-3-yl]anilino)-2-oxoethyl] (E)-3-(2-methylphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 7849511 |
| Molecular Formula | C22H23NO5S |
| Molecular Weight | 413.50 g/mol |
| Exact Mass | 413.13 |
| IUPAC Name | [2-(N-[(3R)-1,1-dioxothiolan-3-yl]anilino)-2-oxoethyl] (E)-3-(2-methylphenyl)prop-2-enoate |
| SMILES | Cc1ccccc1/C=C/C(=O)OCC(=O)N(c1ccccc1)[C@@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C22H23NO5S/c1-17-7-5-6-8-18(17)11-12-22(25)28-15-21(24)23(19-9-3-2-4-10-19)20-13-14-29(26,27)16-20/h2-12,20H,13-16H2,1H3/b12-11+/t20-/m1/s1 |
| InChIKey | FRKYQUANAJGXFL-YVNCXZRQSA-N |
| XLogP | 2.77 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.50 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|