C21H29NO6S — CID 55322272
[2-[butyl-(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl] (E)-3-(2-ethoxyphenyl)prop-2-enoate (PubChem CID 55322272) has the molecular formula C21H29NO6S and a molecular weight of 423.53 g/mol. Its IUPAC name is [2-[butyl-(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl] (E)-3-(2-ethoxyphenyl)prop-2-enoate.
| Compound Name | [2-[butyl-(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl] (E)-3-(2-ethoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 55322272 |
| Molecular Formula | C21H29NO6S |
| Molecular Weight | 423.53 g/mol |
| Exact Mass | 423.17 |
| IUPAC Name | [2-[butyl-(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl] (E)-3-(2-ethoxyphenyl)prop-2-enoate |
| SMILES | CCCCN(C(=O)COC(=O)/C=C/c1ccccc1OCC)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C21H29NO6S/c1-3-5-13-22(18-12-14-29(25,26)16-18)20(23)15-28-21(24)11-10-17-8-6-7-9-19(17)27-4-2/h6-11,18H,3-5,12-16H2,1-2H3/b11-10+ |
| InChIKey | YCPIPPQHFPZYQJ-ZHACJKMWSA-N |
| XLogP | 2.46 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.53 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|