C15H19NO6S — CID 2506452
[2-[[(3R)-1,1-dioxothiolan-3-yl]-ethylamino]-2-oxoethyl] (E)-3-(furan-2-yl)prop-2-enoate (PubChem CID 2506452) has the molecular formula C15H19NO6S and a molecular weight of 341.38 g/mol. Its IUPAC name is [2-[[(3R)-1,1-dioxothiolan-3-yl]-ethylamino]-2-oxoethyl] (E)-3-(furan-2-yl)prop-2-enoate.
| Compound Name | [2-[[(3R)-1,1-dioxothiolan-3-yl]-ethylamino]-2-oxoethyl] (E)-3-(furan-2-yl)prop-2-enoate |
|---|---|
| PubChem CID | 2506452 |
| Molecular Formula | C15H19NO6S |
| Molecular Weight | 341.38 g/mol |
| Exact Mass | 341.09 |
| IUPAC Name | [2-[[(3R)-1,1-dioxothiolan-3-yl]-ethylamino]-2-oxoethyl] (E)-3-(furan-2-yl)prop-2-enoate |
| SMILES | CCN(C(=O)COC(=O)/C=C/c1ccco1)[C@@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C15H19NO6S/c1-2-16(12-7-9-23(19,20)11-12)14(17)10-22-15(18)6-5-13-4-3-8-21-13/h3-6,8,12H,2,7,9-11H2,1H3/b6-5+/t12-/m1/s1 |
| InChIKey | VADBVCRYDJYUDU-BTDICHCPSA-N |
| XLogP | 0.87 |
| TPSA | 93.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.38 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|