C19H21NO4S — CID 18818254
(Z)-N-(1,1-dioxothiolan-3-yl)-3-(furan-2-yl)-N-[(4-methylphenyl)methyl]prop-2-enamide (PubChem CID 18818254) has the molecular formula C19H21NO4S and a molecular weight of 359.45 g/mol. Its IUPAC name is (Z)-N-(1,1-dioxothiolan-3-yl)-3-(furan-2-yl)-N-[(4-methylphenyl)methyl]prop-2-enamide.
| Compound Name | (Z)-N-(1,1-dioxothiolan-3-yl)-3-(furan-2-yl)-N-[(4-methylphenyl)methyl]prop-2-enamide |
|---|---|
| PubChem CID | 18818254 |
| Molecular Formula | C19H21NO4S |
| Molecular Weight | 359.45 g/mol |
| Exact Mass | 359.12 |
| IUPAC Name | (Z)-N-(1,1-dioxothiolan-3-yl)-3-(furan-2-yl)-N-[(4-methylphenyl)methyl]prop-2-enamide |
| SMILES | Cc1ccc(CN(C(=O)/C=C\c2ccco2)C2CCS(=O)(=O)C2)cc1 |
| InChI | InChI=1S/C19H21NO4S/c1-15-4-6-16(7-5-15)13-20(17-10-12-25(22,23)14-17)19(21)9-8-18-3-2-11-24-18/h2-9,11,17H,10,12-14H2,1H3/b9-8- |
| InChIKey | XKPALEXLJZWQTM-HJWRWDBZSA-N |
| XLogP | 2.82 |
| TPSA | 67.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.45 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|