C20H23NO5S — CID 19244287
(E)-N-(1,1-dioxothiolan-3-yl)-3-(furan-2-yl)-N-[[5-(2-methylcyclopropyl)furan-2-yl]methyl]prop-2-enamide (PubChem CID 19244287) has the molecular formula C20H23NO5S and a molecular weight of 389.47 g/mol. Its IUPAC name is (E)-N-(1,1-dioxothiolan-3-yl)-3-(furan-2-yl)-N-[[5-(2-methylcyclopropyl)furan-2-yl]methyl]prop-2-enamide.
| Compound Name | (E)-N-(1,1-dioxothiolan-3-yl)-3-(furan-2-yl)-N-[[5-(2-methylcyclopropyl)furan-2-yl]methyl]prop-2-enamide |
|---|---|
| PubChem CID | 19244287 |
| Molecular Formula | C20H23NO5S |
| Molecular Weight | 389.47 g/mol |
| Exact Mass | 389.13 |
| IUPAC Name | (E)-N-(1,1-dioxothiolan-3-yl)-3-(furan-2-yl)-N-[[5-(2-methylcyclopropyl)furan-2-yl]methyl]prop-2-enamide |
| SMILES | CC1CC1c1ccc(CN(C(=O)/C=C/c2ccco2)C2CCS(=O)(=O)C2)o1 |
| InChI | InChI=1S/C20H23NO5S/c1-14-11-18(14)19-6-4-17(26-19)12-21(15-8-10-27(23,24)13-15)20(22)7-5-16-3-2-9-25-16/h2-7,9,14-15,18H,8,10-13H2,1H3/b7-5+ |
| InChIKey | LGLPYPNHFOKFAA-FNORWQNLSA-N |
| XLogP | 3.23 |
| TPSA | 80.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.47 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|