C16H16BrNO4S2 — CID 42886385
(E)-3-(5-bromothiophen-2-yl)-N-(1,1-dioxothiolan-3-yl)-N-(furan-2-ylmethyl)prop-2-enamide (PubChem CID 42886385) has the molecular formula C16H16BrNO4S2 and a molecular weight of 430.35 g/mol. Its IUPAC name is (E)-3-(5-bromothiophen-2-yl)-N-(1,1-dioxothiolan-3-yl)-N-(furan-2-ylmethyl)prop-2-enamide.
| Compound Name | (E)-3-(5-bromothiophen-2-yl)-N-(1,1-dioxothiolan-3-yl)-N-(furan-2-ylmethyl)prop-2-enamide |
|---|---|
| PubChem CID | 42886385 |
| Molecular Formula | C16H16BrNO4S2 |
| Molecular Weight | 430.35 g/mol |
| Exact Mass | 428.97 |
| IUPAC Name | (E)-3-(5-bromothiophen-2-yl)-N-(1,1-dioxothiolan-3-yl)-N-(furan-2-ylmethyl)prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(Br)s1)N(Cc1ccco1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C16H16BrNO4S2/c17-15-5-3-14(23-15)4-6-16(19)18(10-13-2-1-8-22-13)12-7-9-24(20,21)11-12/h1-6,8,12H,7,9-11H2/b6-4+ |
| InChIKey | AJEFSXZRZVGHIG-GQCTYLIASA-N |
| XLogP | 3.33 |
| TPSA | 67.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.35 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|