C23H23N3O5S2 — CID 6216223
(E)-3-[2-(N-acetylanilino)-1,3-thiazol-4-yl]-N-(1,1-dioxothiolan-3-yl)-N-(furan-2-ylmethyl)prop-2-enamide (PubChem CID 6216223) has the molecular formula C23H23N3O5S2 and a molecular weight of 485.59 g/mol. Its IUPAC name is (E)-3-[2-(N-acetylanilino)-1,3-thiazol-4-yl]-N-(1,1-dioxothiolan-3-yl)-N-(furan-2-ylmethyl)prop-2-enamide.
| Compound Name | (E)-3-[2-(N-acetylanilino)-1,3-thiazol-4-yl]-N-(1,1-dioxothiolan-3-yl)-N-(furan-2-ylmethyl)prop-2-enamide |
|---|---|
| PubChem CID | 6216223 |
| Molecular Formula | C23H23N3O5S2 |
| Molecular Weight | 485.59 g/mol |
| Exact Mass | 485.11 |
| IUPAC Name | (E)-3-[2-(N-acetylanilino)-1,3-thiazol-4-yl]-N-(1,1-dioxothiolan-3-yl)-N-(furan-2-ylmethyl)prop-2-enamide |
| SMILES | CC(=O)N(c1ccccc1)c1nc(/C=C/C(=O)N(Cc2ccco2)C2CCS(=O)(=O)C2)cs1 |
| InChI | InChI=1S/C23H23N3O5S2/c1-17(27)26(19-6-3-2-4-7-19)23-24-18(15-32-23)9-10-22(28)25(14-21-8-5-12-31-21)20-11-13-33(29,30)16-20/h2-10,12,15,20H,11,13-14,16H2,1H3/b10-9+ |
| InChIKey | APVPCRQFDDRHLZ-MDZDMXLPSA-N |
| XLogP | 3.65 |
| TPSA | 100.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.59 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|