C22H20FN3O2S — CID 76856850
3-[2-(N-acetylanilino)-1,3-thiazol-4-yl]-N-[(4-fluorophenyl)methyl]-N-methylprop-2-enamide (PubChem CID 76856850) has the molecular formula C22H20FN3O2S and a molecular weight of 409.49 g/mol. Its IUPAC name is 3-[2-(N-acetylanilino)-1,3-thiazol-4-yl]-N-[(4-fluorophenyl)methyl]-N-methylprop-2-enamide.
| Compound Name | 3-[2-(N-acetylanilino)-1,3-thiazol-4-yl]-N-[(4-fluorophenyl)methyl]-N-methylprop-2-enamide |
|---|---|
| PubChem CID | 76856850 |
| Molecular Formula | C22H20FN3O2S |
| Molecular Weight | 409.49 g/mol |
| Exact Mass | 409.13 |
| IUPAC Name | 3-[2-(N-acetylanilino)-1,3-thiazol-4-yl]-N-[(4-fluorophenyl)methyl]-N-methylprop-2-enamide |
| SMILES | CC(=O)N(c1ccccc1)c1nc(C=CC(=O)N(C)Cc2ccc(F)cc2)cs1 |
| InChI | InChI=1S/C22H20FN3O2S/c1-16(27)26(20-6-4-3-5-7-20)22-24-19(15-29-22)12-13-21(28)25(2)14-17-8-10-18(23)11-9-17/h3-13,15H,14H2,1-2H3 |
| InChIKey | FFWMRSUYPPSVKT-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.49 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|