C23H23N3O2S — CID 9427302
(E)-3-[2-(N-acetylanilino)-1,3-thiazol-4-yl]-N-[(2R)-2-phenylpropyl]prop-2-enamide (PubChem CID 9427302) has the molecular formula C23H23N3O2S and a molecular weight of 405.52 g/mol. Its IUPAC name is (E)-3-[2-(N-acetylanilino)-1,3-thiazol-4-yl]-N-[(2R)-2-phenylpropyl]prop-2-enamide.
| Compound Name | (E)-3-[2-(N-acetylanilino)-1,3-thiazol-4-yl]-N-[(2R)-2-phenylpropyl]prop-2-enamide |
|---|---|
| PubChem CID | 9427302 |
| Molecular Formula | C23H23N3O2S |
| Molecular Weight | 405.52 g/mol |
| Exact Mass | 405.15 |
| IUPAC Name | (E)-3-[2-(N-acetylanilino)-1,3-thiazol-4-yl]-N-[(2R)-2-phenylpropyl]prop-2-enamide |
| SMILES | CC(=O)N(c1ccccc1)c1nc(/C=C/C(=O)NC[C@H](C)c2ccccc2)cs1 |
| InChI | InChI=1S/C23H23N3O2S/c1-17(19-9-5-3-6-10-19)15-24-22(28)14-13-20-16-29-23(25-20)26(18(2)27)21-11-7-4-8-12-21/h3-14,16-17H,15H2,1-2H3,(H,24,28)/b14-13+/t17-/m0/s1 |
| InChIKey | FPVSCYSABWFMRJ-CLVCIHKQSA-N |
| XLogP | 4.76 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.52 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|