C22H18F3N3O3S — CID 34322585
(E)-3-[2-(N-acetylanilino)-1,3-thiazol-4-yl]-N-[[2-(trifluoromethoxy)phenyl]methyl]prop-2-enamide (PubChem CID 34322585) has the molecular formula C22H18F3N3O3S and a molecular weight of 461.47 g/mol. Its IUPAC name is (E)-3-[2-(N-acetylanilino)-1,3-thiazol-4-yl]-N-[[2-(trifluoromethoxy)phenyl]methyl]prop-2-enamide.
| Compound Name | (E)-3-[2-(N-acetylanilino)-1,3-thiazol-4-yl]-N-[[2-(trifluoromethoxy)phenyl]methyl]prop-2-enamide |
|---|---|
| PubChem CID | 34322585 |
| Molecular Formula | C22H18F3N3O3S |
| Molecular Weight | 461.47 g/mol |
| Exact Mass | 461.10 |
| IUPAC Name | (E)-3-[2-(N-acetylanilino)-1,3-thiazol-4-yl]-N-[[2-(trifluoromethoxy)phenyl]methyl]prop-2-enamide |
| SMILES | CC(=O)N(c1ccccc1)c1nc(/C=C/C(=O)NCc2ccccc2OC(F)(F)F)cs1 |
| InChI | InChI=1S/C22H18F3N3O3S/c1-15(29)28(18-8-3-2-4-9-18)21-27-17(14-32-21)11-12-20(30)26-13-16-7-5-6-10-19(16)31-22(23,24)25/h2-12,14H,13H2,1H3,(H,26,30)/b12-11+ |
| InChIKey | WWQQCJUEAIEWPW-VAWYXSNFSA-N |
| XLogP | 5.06 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.47 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|