C20H25N3O2S — CID 75128821
3-[2-(N-acetylanilino)-1,3-thiazol-4-yl]-N-hexylprop-2-enamide (PubChem CID 75128821) has the molecular formula C20H25N3O2S and a molecular weight of 371.51 g/mol. Its IUPAC name is 3-[2-(N-acetylanilino)-1,3-thiazol-4-yl]-N-hexylprop-2-enamide.
| Compound Name | 3-[2-(N-acetylanilino)-1,3-thiazol-4-yl]-N-hexylprop-2-enamide |
|---|---|
| PubChem CID | 75128821 |
| Molecular Formula | C20H25N3O2S |
| Molecular Weight | 371.51 g/mol |
| Exact Mass | 371.17 |
| IUPAC Name | 3-[2-(N-acetylanilino)-1,3-thiazol-4-yl]-N-hexylprop-2-enamide |
| SMILES | CCCCCCNC(=O)C=Cc1csc(N(C(C)=O)c2ccccc2)n1 |
| InChI | InChI=1S/C20H25N3O2S/c1-3-4-5-9-14-21-19(25)13-12-17-15-26-20(22-17)23(16(2)24)18-10-7-6-8-11-18/h6-8,10-13,15H,3-5,9,14H2,1-2H3,(H,21,25) |
| InChIKey | MPZUUWVZGVWUAN-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.51 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|