C22H21N3O2S — CID 78758975
3-[2-(N-acetylanilino)-1,3-thiazol-4-yl]-N-(2,5-dimethylphenyl)prop-2-enamide (PubChem CID 78758975) has the molecular formula C22H21N3O2S and a molecular weight of 391.50 g/mol. Its IUPAC name is 3-[2-(N-acetylanilino)-1,3-thiazol-4-yl]-N-(2,5-dimethylphenyl)prop-2-enamide.
| Compound Name | 3-[2-(N-acetylanilino)-1,3-thiazol-4-yl]-N-(2,5-dimethylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 78758975 |
| Molecular Formula | C22H21N3O2S |
| Molecular Weight | 391.50 g/mol |
| Exact Mass | 391.14 |
| IUPAC Name | 3-[2-(N-acetylanilino)-1,3-thiazol-4-yl]-N-(2,5-dimethylphenyl)prop-2-enamide |
| SMILES | CC(=O)N(c1ccccc1)c1nc(C=CC(=O)Nc2cc(C)ccc2C)cs1 |
| InChI | InChI=1S/C22H21N3O2S/c1-15-9-10-16(2)20(13-15)24-21(27)12-11-18-14-28-22(23-18)25(17(3)26)19-7-5-4-6-8-19/h4-14H,1-3H3,(H,24,27) |
| InChIKey | WKOQHESBIABJQB-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.50 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|