C24H23N3O4S — CID 24655997
(E)-3-[2-(N-acetylanilino)-1,3-thiazol-4-yl]-N-(1,3-benzodioxol-5-ylmethyl)-N-ethylprop-2-enamide (PubChem CID 24655997) has the molecular formula C24H23N3O4S and a molecular weight of 449.53 g/mol. Its IUPAC name is (E)-3-[2-(N-acetylanilino)-1,3-thiazol-4-yl]-N-(1,3-benzodioxol-5-ylmethyl)-N-ethylprop-2-enamide.
| Compound Name | (E)-3-[2-(N-acetylanilino)-1,3-thiazol-4-yl]-N-(1,3-benzodioxol-5-ylmethyl)-N-ethylprop-2-enamide |
|---|---|
| PubChem CID | 24655997 |
| Molecular Formula | C24H23N3O4S |
| Molecular Weight | 449.53 g/mol |
| Exact Mass | 449.14 |
| IUPAC Name | (E)-3-[2-(N-acetylanilino)-1,3-thiazol-4-yl]-N-(1,3-benzodioxol-5-ylmethyl)-N-ethylprop-2-enamide |
| SMILES | CCN(Cc1ccc2c(c1)OCO2)C(=O)/C=C/c1csc(N(C(C)=O)c2ccccc2)n1 |
| InChI | InChI=1S/C24H23N3O4S/c1-3-26(14-18-9-11-21-22(13-18)31-16-30-21)23(29)12-10-19-15-32-24(25-19)27(17(2)28)20-7-5-4-6-8-20/h4-13,15H,3,14,16H2,1-2H3/b12-10+ |
| InChIKey | CMDXUJVOLSZNLU-ZRDIBKRKSA-N |
| XLogP | 4.62 |
| TPSA | 71.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.53 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|