C23H23N3O3S — CID 29219581
(E)-3-[2-(N-acetylanilino)-1,3-thiazol-4-yl]-N-[(4-methoxyphenyl)methyl]-N-methylprop-2-enamide (PubChem CID 29219581) has the molecular formula C23H23N3O3S and a molecular weight of 421.52 g/mol. Its IUPAC name is (E)-3-[2-(N-acetylanilino)-1,3-thiazol-4-yl]-N-[(4-methoxyphenyl)methyl]-N-methylprop-2-enamide.
| Compound Name | (E)-3-[2-(N-acetylanilino)-1,3-thiazol-4-yl]-N-[(4-methoxyphenyl)methyl]-N-methylprop-2-enamide |
|---|---|
| PubChem CID | 29219581 |
| Molecular Formula | C23H23N3O3S |
| Molecular Weight | 421.52 g/mol |
| Exact Mass | 421.15 |
| IUPAC Name | (E)-3-[2-(N-acetylanilino)-1,3-thiazol-4-yl]-N-[(4-methoxyphenyl)methyl]-N-methylprop-2-enamide |
| SMILES | COc1ccc(CN(C)C(=O)/C=C/c2csc(N(C(C)=O)c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C23H23N3O3S/c1-17(27)26(20-7-5-4-6-8-20)23-24-19(16-30-23)11-14-22(28)25(2)15-18-9-12-21(29-3)13-10-18/h4-14,16H,15H2,1-3H3/b14-11+ |
| InChIKey | QWAKBEIJRIXAGV-SDNWHVSQSA-N |
| XLogP | 4.51 |
| TPSA | 62.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.52 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|