C27H25N3O2S2 — CID 24677046
(E)-3-[2-(N-acetylanilino)-1,3-thiazol-4-yl]-N-(2-phenylethyl)-N-(thiophen-2-ylmethyl)prop-2-enamide (PubChem CID 24677046) has the molecular formula C27H25N3O2S2 and a molecular weight of 487.65 g/mol. Its IUPAC name is (E)-3-[2-(N-acetylanilino)-1,3-thiazol-4-yl]-N-(2-phenylethyl)-N-(thiophen-2-ylmethyl)prop-2-enamide.
| Compound Name | (E)-3-[2-(N-acetylanilino)-1,3-thiazol-4-yl]-N-(2-phenylethyl)-N-(thiophen-2-ylmethyl)prop-2-enamide |
|---|---|
| PubChem CID | 24677046 |
| Molecular Formula | C27H25N3O2S2 |
| Molecular Weight | 487.65 g/mol |
| Exact Mass | 487.14 |
| IUPAC Name | (E)-3-[2-(N-acetylanilino)-1,3-thiazol-4-yl]-N-(2-phenylethyl)-N-(thiophen-2-ylmethyl)prop-2-enamide |
| SMILES | CC(=O)N(c1ccccc1)c1nc(/C=C/C(=O)N(CCc2ccccc2)Cc2cccs2)cs1 |
| InChI | InChI=1S/C27H25N3O2S2/c1-21(31)30(24-11-6-3-7-12-24)27-28-23(20-34-27)14-15-26(32)29(19-25-13-8-18-33-25)17-16-22-9-4-2-5-10-22/h2-15,18,20H,16-17,19H2,1H3/b15-14+ |
| InChIKey | ICUGYCUETZRKPR-CCEZHUSRSA-N |
| XLogP | 6.17 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.65 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|