C20H23N3O2S — CID 26244284
N-[4-[(E)-3-(4-methylpiperidin-1-yl)-3-oxoprop-1-enyl]-1,3-thiazol-2-yl]-N-phenylacetamide (PubChem CID 26244284) has the molecular formula C20H23N3O2S and a molecular weight of 369.49 g/mol. Its IUPAC name is N-[4-[(E)-3-(4-methylpiperidin-1-yl)-3-oxoprop-1-enyl]-1,3-thiazol-2-yl]-N-phenylacetamide.
| Compound Name | N-[4-[(E)-3-(4-methylpiperidin-1-yl)-3-oxoprop-1-enyl]-1,3-thiazol-2-yl]-N-phenylacetamide |
|---|---|
| PubChem CID | 26244284 |
| Molecular Formula | C20H23N3O2S |
| Molecular Weight | 369.49 g/mol |
| Exact Mass | 369.15 |
| IUPAC Name | N-[4-[(E)-3-(4-methylpiperidin-1-yl)-3-oxoprop-1-enyl]-1,3-thiazol-2-yl]-N-phenylacetamide |
| SMILES | CC(=O)N(c1ccccc1)c1nc(/C=C/C(=O)N2CCC(C)CC2)cs1 |
| InChI | InChI=1S/C20H23N3O2S/c1-15-10-12-22(13-11-15)19(25)9-8-17-14-26-20(21-17)23(16(2)24)18-6-4-3-5-7-18/h3-9,14-15H,10-13H2,1-2H3/b9-8+ |
| InChIKey | RUJVNULZUUYINM-CMDGGOBGSA-N |
| XLogP | 4.10 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.49 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|