C23H21N3O2S2 — CID 41295095
(E)-3-[2-(N-acetylanilino)-1,3-thiazol-4-yl]-N-[(4R)-3,4-dihydro-2H-thiochromen-4-yl]prop-2-enamide (PubChem CID 41295095) has the molecular formula C23H21N3O2S2 and a molecular weight of 435.57 g/mol. Its IUPAC name is (E)-3-[2-(N-acetylanilino)-1,3-thiazol-4-yl]-N-[(4R)-3,4-dihydro-2H-thiochromen-4-yl]prop-2-enamide.
| Compound Name | (E)-3-[2-(N-acetylanilino)-1,3-thiazol-4-yl]-N-[(4R)-3,4-dihydro-2H-thiochromen-4-yl]prop-2-enamide |
|---|---|
| PubChem CID | 41295095 |
| Molecular Formula | C23H21N3O2S2 |
| Molecular Weight | 435.57 g/mol |
| Exact Mass | 435.11 |
| IUPAC Name | (E)-3-[2-(N-acetylanilino)-1,3-thiazol-4-yl]-N-[(4R)-3,4-dihydro-2H-thiochromen-4-yl]prop-2-enamide |
| SMILES | CC(=O)N(c1ccccc1)c1nc(/C=C/C(=O)N[C@@H]2CCSc3ccccc32)cs1 |
| InChI | InChI=1S/C23H21N3O2S2/c1-16(27)26(18-7-3-2-4-8-18)23-24-17(15-30-23)11-12-22(28)25-20-13-14-29-21-10-6-5-9-19(20)21/h2-12,15,20H,13-14H2,1H3,(H,25,28)/b12-11+/t20-/m1/s1 |
| InChIKey | JOTOIGPMKCXAAQ-YVNCXZRQSA-N |
| XLogP | 5.19 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.57 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|