C25H22N4O2S2 — CID 4875753
N-[4-[3-[2-(1,3-benzothiazol-2-yl)pyrrolidin-1-yl]-3-oxoprop-1-enyl]-1,3-thiazol-2-yl]-N-phenylacetamide (PubChem CID 4875753) has the molecular formula C25H22N4O2S2 and a molecular weight of 474.61 g/mol. Its IUPAC name is N-[4-[3-[2-(1,3-benzothiazol-2-yl)pyrrolidin-1-yl]-3-oxoprop-1-enyl]-1,3-thiazol-2-yl]-N-phenylacetamide.
| Compound Name | N-[4-[3-[2-(1,3-benzothiazol-2-yl)pyrrolidin-1-yl]-3-oxoprop-1-enyl]-1,3-thiazol-2-yl]-N-phenylacetamide |
|---|---|
| PubChem CID | 4875753 |
| Molecular Formula | C25H22N4O2S2 |
| Molecular Weight | 474.61 g/mol |
| Exact Mass | 474.12 |
| IUPAC Name | N-[4-[3-[2-(1,3-benzothiazol-2-yl)pyrrolidin-1-yl]-3-oxoprop-1-enyl]-1,3-thiazol-2-yl]-N-phenylacetamide |
| SMILES | CC(=O)N(c1ccccc1)c1nc(C=CC(=O)N2CCCC2c2nc3ccccc3s2)cs1 |
| InChI | InChI=1S/C25H22N4O2S2/c1-17(30)29(19-8-3-2-4-9-19)25-26-18(16-32-25)13-14-23(31)28-15-7-11-21(28)24-27-20-10-5-6-12-22(20)33-24/h2-6,8-10,12-14,16,21H,7,11,15H2,1H3 |
| InChIKey | QHSQVHVGEJNMDE-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 66.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.61 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|