C22H21N3O3 — CID 46534299
(E)-N-(1,3-benzodioxol-5-ylmethyl)-N-ethyl-3-(1-phenylpyrazol-4-yl)prop-2-enamide (PubChem CID 46534299) has the molecular formula C22H21N3O3 and a molecular weight of 375.43 g/mol. Its IUPAC name is (E)-N-(1,3-benzodioxol-5-ylmethyl)-N-ethyl-3-(1-phenylpyrazol-4-yl)prop-2-enamide.
| Compound Name | (E)-N-(1,3-benzodioxol-5-ylmethyl)-N-ethyl-3-(1-phenylpyrazol-4-yl)prop-2-enamide |
|---|---|
| PubChem CID | 46534299 |
| Molecular Formula | C22H21N3O3 |
| Molecular Weight | 375.43 g/mol |
| Exact Mass | 375.16 |
| IUPAC Name | (E)-N-(1,3-benzodioxol-5-ylmethyl)-N-ethyl-3-(1-phenylpyrazol-4-yl)prop-2-enamide |
| SMILES | CCN(Cc1ccc2c(c1)OCO2)C(=O)/C=C/c1cnn(-c2ccccc2)c1 |
| InChI | InChI=1S/C22H21N3O3/c1-2-24(14-17-8-10-20-21(12-17)28-16-27-20)22(26)11-9-18-13-23-25(15-18)19-6-4-3-5-7-19/h3-13,15H,2,14,16H2,1H3/b11-9+ |
| InChIKey | RNQWWDDSUQYEST-PKNBQFBNSA-N |
| XLogP | 3.66 |
| TPSA | 56.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.43 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|