C22H19N3OS2 — CID 31839809
(E)-3-(1-phenylpyrazol-4-yl)-N,N-bis(thiophen-2-ylmethyl)prop-2-enamide (PubChem CID 31839809) has the molecular formula C22H19N3OS2 and a molecular weight of 405.55 g/mol. Its IUPAC name is (E)-3-(1-phenylpyrazol-4-yl)-N,N-bis(thiophen-2-ylmethyl)prop-2-enamide.
| Compound Name | (E)-3-(1-phenylpyrazol-4-yl)-N,N-bis(thiophen-2-ylmethyl)prop-2-enamide |
|---|---|
| PubChem CID | 31839809 |
| Molecular Formula | C22H19N3OS2 |
| Molecular Weight | 405.55 g/mol |
| Exact Mass | 405.10 |
| IUPAC Name | (E)-3-(1-phenylpyrazol-4-yl)-N,N-bis(thiophen-2-ylmethyl)prop-2-enamide |
| SMILES | O=C(/C=C/c1cnn(-c2ccccc2)c1)N(Cc1cccs1)Cc1cccs1 |
| InChI | InChI=1S/C22H19N3OS2/c26-22(11-10-18-14-23-25(15-18)19-6-2-1-3-7-19)24(16-20-8-4-12-27-20)17-21-9-5-13-28-21/h1-15H,16-17H2/b11-10+ |
| InChIKey | DZTHHPOAMSEGBA-ZHACJKMWSA-N |
| XLogP | 5.24 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.55 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|