C20H19NOS2 — CID 31837807
(E)-3-(4-methylphenyl)-N,N-bis(thiophen-2-ylmethyl)prop-2-enamide (PubChem CID 31837807) has the molecular formula C20H19NOS2 and a molecular weight of 353.51 g/mol. Its IUPAC name is (E)-3-(4-methylphenyl)-N,N-bis(thiophen-2-ylmethyl)prop-2-enamide.
| Compound Name | (E)-3-(4-methylphenyl)-N,N-bis(thiophen-2-ylmethyl)prop-2-enamide |
|---|---|
| PubChem CID | 31837807 |
| Molecular Formula | C20H19NOS2 |
| Molecular Weight | 353.51 g/mol |
| Exact Mass | 353.09 |
| IUPAC Name | (E)-3-(4-methylphenyl)-N,N-bis(thiophen-2-ylmethyl)prop-2-enamide |
| SMILES | Cc1ccc(/C=C/C(=O)N(Cc2cccs2)Cc2cccs2)cc1 |
| InChI | InChI=1S/C20H19NOS2/c1-16-6-8-17(9-7-16)10-11-20(22)21(14-18-4-2-12-23-18)15-19-5-3-13-24-19/h2-13H,14-15H2,1H3/b11-10+ |
| InChIKey | SYIDLOFMGRIATA-ZHACJKMWSA-N |
| XLogP | 5.36 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.51 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|