C13H17NOS — CID 78802720
N-ethyl-N-(thiophen-2-ylmethyl)hexa-2,4-dienamide (PubChem CID 78802720) has the molecular formula C13H17NOS and a molecular weight of 235.35 g/mol. Its IUPAC name is N-ethyl-N-(thiophen-2-ylmethyl)hexa-2,4-dienamide.
| Compound Name | N-ethyl-N-(thiophen-2-ylmethyl)hexa-2,4-dienamide |
|---|---|
| PubChem CID | 78802720 |
| Molecular Formula | C13H17NOS |
| Molecular Weight | 235.35 g/mol |
| Exact Mass | 235.10 |
| IUPAC Name | N-ethyl-N-(thiophen-2-ylmethyl)hexa-2,4-dienamide |
| SMILES | CC=CC=CC(=O)N(CC)Cc1cccs1 |
| InChI | InChI=1S/C13H17NOS/c1-3-5-6-9-13(15)14(4-2)11-12-8-7-10-16-12/h3,5-10H,4,11H2,1-2H3 |
| InChIKey | WWCPAVXEOKWBPL-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.35 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|