C11H18N2OS — CID 116654591
1,3-diethyl-1-methyl-3-(thiophen-2-ylmethyl)urea (PubChem CID 116654591) has the molecular formula C11H18N2OS and a molecular weight of 226.34 g/mol. Its IUPAC name is 1,3-diethyl-1-methyl-3-(thiophen-2-ylmethyl)urea.
| Compound Name | 1,3-diethyl-1-methyl-3-(thiophen-2-ylmethyl)urea |
|---|---|
| PubChem CID | 116654591 |
| Molecular Formula | C11H18N2OS |
| Molecular Weight | 226.34 g/mol |
| Exact Mass | 226.11 |
| IUPAC Name | 1,3-diethyl-1-methyl-3-(thiophen-2-ylmethyl)urea |
| SMILES | CCN(C)C(=O)N(CC)Cc1cccs1 |
| InChI | InChI=1S/C11H18N2OS/c1-4-12(3)11(14)13(5-2)9-10-7-6-8-15-10/h6-8H,4-5,9H2,1-3H3 |
| InChIKey | CHUOXAYDDKOIKI-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.34 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |