C21H21NOS — CID 134014388
N-ethyl-2,2-diphenyl-N-(thiophen-2-ylmethyl)acetamide (PubChem CID 134014388) has the molecular formula C21H21NOS and a molecular weight of 335.47 g/mol. Its IUPAC name is N-ethyl-2,2-diphenyl-N-(thiophen-2-ylmethyl)acetamide.
| Compound Name | N-ethyl-2,2-diphenyl-N-(thiophen-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 134014388 |
| Molecular Formula | C21H21NOS |
| Molecular Weight | 335.47 g/mol |
| Exact Mass | 335.13 |
| IUPAC Name | N-ethyl-2,2-diphenyl-N-(thiophen-2-ylmethyl)acetamide |
| SMILES | CCN(Cc1cccs1)C(=O)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H21NOS/c1-2-22(16-19-14-9-15-24-19)21(23)20(17-10-5-3-6-11-17)18-12-7-4-8-13-18/h3-15,20H,2,16H2,1H3 |
| InChIKey | ZRPWZKZDXBYATN-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.47 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |