C14H17NOS2 — CID 78801832
N-ethyl-3-thiophen-2-yl-N-(thiophen-2-ylmethyl)propanamide (PubChem CID 78801832) has the molecular formula C14H17NOS2 and a molecular weight of 279.43 g/mol. Its IUPAC name is N-ethyl-3-thiophen-2-yl-N-(thiophen-2-ylmethyl)propanamide.
| Compound Name | N-ethyl-3-thiophen-2-yl-N-(thiophen-2-ylmethyl)propanamide |
|---|---|
| PubChem CID | 78801832 |
| Molecular Formula | C14H17NOS2 |
| Molecular Weight | 279.43 g/mol |
| Exact Mass | 279.08 |
| IUPAC Name | N-ethyl-3-thiophen-2-yl-N-(thiophen-2-ylmethyl)propanamide |
| SMILES | CCN(Cc1cccs1)C(=O)CCc1cccs1 |
| InChI | InChI=1S/C14H17NOS2/c1-2-15(11-13-6-4-10-18-13)14(16)8-7-12-5-3-9-17-12/h3-6,9-10H,2,7-8,11H2,1H3 |
| InChIKey | YLZSXANUYBFKJC-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.43 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |