C15H18N2O2S2 — CID 18163378
N-[3-[ethyl(thiophen-2-ylmethyl)amino]-3-oxopropyl]thiophene-3-carboxamide (PubChem CID 18163378) has the molecular formula C15H18N2O2S2 and a molecular weight of 322.45 g/mol. Its IUPAC name is N-[3-[ethyl(thiophen-2-ylmethyl)amino]-3-oxopropyl]thiophene-3-carboxamide.
| Compound Name | N-[3-[ethyl(thiophen-2-ylmethyl)amino]-3-oxopropyl]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 18163378 |
| Molecular Formula | C15H18N2O2S2 |
| Molecular Weight | 322.45 g/mol |
| Exact Mass | 322.08 |
| IUPAC Name | N-[3-[ethyl(thiophen-2-ylmethyl)amino]-3-oxopropyl]thiophene-3-carboxamide |
| SMILES | CCN(Cc1cccs1)C(=O)CCNC(=O)c1ccsc1 |
| InChI | InChI=1S/C15H18N2O2S2/c1-2-17(10-13-4-3-8-21-13)14(18)5-7-16-15(19)12-6-9-20-11-12/h3-4,6,8-9,11H,2,5,7,10H2,1H3,(H,16,19) |
| InChIKey | NUROHGUYMKJAJM-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.45 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |