C12H14N2O6S — CID 63645564
2-[carboxymethyl-[3-(thiophene-3-carbonylamino)propanoyl]amino]acetic acid (PubChem CID 63645564) has the molecular formula C12H14N2O6S and a molecular weight of 314.32 g/mol. Its IUPAC name is 2-[carboxymethyl-[3-(thiophene-3-carbonylamino)propanoyl]amino]acetic acid.
| Compound Name | 2-[carboxymethyl-[3-(thiophene-3-carbonylamino)propanoyl]amino]acetic acid |
|---|---|
| PubChem CID | 63645564 |
| Molecular Formula | C12H14N2O6S |
| Molecular Weight | 314.32 g/mol |
| Exact Mass | 314.06 |
| IUPAC Name | 2-[carboxymethyl-[3-(thiophene-3-carbonylamino)propanoyl]amino]acetic acid |
| SMILES | O=C(O)CN(CC(=O)O)C(=O)CCNC(=O)c1ccsc1 |
| InChI | InChI=1S/C12H14N2O6S/c15-9(14(5-10(16)17)6-11(18)19)1-3-13-12(20)8-2-4-21-7-8/h2,4,7H,1,3,5-6H2,(H,13,20)(H,16,17)(H,18,19) |
| InChIKey | DZGXEXBHQINFIF-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 124.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.32 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |