C23H24N2O2S — CID 55373105
N-[3-[ethyl(thiophen-2-ylmethyl)amino]-3-oxo-1-phenylpropyl]benzamide (PubChem CID 55373105) has the molecular formula C23H24N2O2S and a molecular weight of 392.52 g/mol. Its IUPAC name is N-[3-[ethyl(thiophen-2-ylmethyl)amino]-3-oxo-1-phenylpropyl]benzamide.
| Compound Name | N-[3-[ethyl(thiophen-2-ylmethyl)amino]-3-oxo-1-phenylpropyl]benzamide |
|---|---|
| PubChem CID | 55373105 |
| Molecular Formula | C23H24N2O2S |
| Molecular Weight | 392.52 g/mol |
| Exact Mass | 392.16 |
| IUPAC Name | N-[3-[ethyl(thiophen-2-ylmethyl)amino]-3-oxo-1-phenylpropyl]benzamide |
| SMILES | CCN(Cc1cccs1)C(=O)CC(NC(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H24N2O2S/c1-2-25(17-20-14-9-15-28-20)22(26)16-21(18-10-5-3-6-11-18)24-23(27)19-12-7-4-8-13-19/h3-15,21H,2,16-17H2,1H3,(H,24,27) |
| InChIKey | UDNKJNDCOUPCBP-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.52 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |