C20H21N3O2S2 — CID 43064243
3-(carbamoylamino)-3-phenyl-N,N-bis(thiophen-2-ylmethyl)propanamide (PubChem CID 43064243) has the molecular formula C20H21N3O2S2 and a molecular weight of 399.54 g/mol. Its IUPAC name is 3-(carbamoylamino)-3-phenyl-N,N-bis(thiophen-2-ylmethyl)propanamide.
| Compound Name | 3-(carbamoylamino)-3-phenyl-N,N-bis(thiophen-2-ylmethyl)propanamide |
|---|---|
| PubChem CID | 43064243 |
| Molecular Formula | C20H21N3O2S2 |
| Molecular Weight | 399.54 g/mol |
| Exact Mass | 399.11 |
| IUPAC Name | 3-(carbamoylamino)-3-phenyl-N,N-bis(thiophen-2-ylmethyl)propanamide |
| SMILES | NC(=O)NC(CC(=O)N(Cc1cccs1)Cc1cccs1)c1ccccc1 |
| InChI | InChI=1S/C20H21N3O2S2/c21-20(25)22-18(15-6-2-1-3-7-15)12-19(24)23(13-16-8-4-10-26-16)14-17-9-5-11-27-17/h1-11,18H,12-14H2,(H3,21,22,25) |
| InChIKey | BBMZXFUZZHPUMK-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.54 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |