C17H20BrN3O2S — CID 42938478
N-[(5-bromothiophen-2-yl)methyl]-3-(carbamoylamino)-N-ethyl-3-phenylpropanamide (PubChem CID 42938478) has the molecular formula C17H20BrN3O2S and a molecular weight of 410.34 g/mol. Its IUPAC name is N-[(5-bromothiophen-2-yl)methyl]-3-(carbamoylamino)-N-ethyl-3-phenylpropanamide.
| Compound Name | N-[(5-bromothiophen-2-yl)methyl]-3-(carbamoylamino)-N-ethyl-3-phenylpropanamide |
|---|---|
| PubChem CID | 42938478 |
| Molecular Formula | C17H20BrN3O2S |
| Molecular Weight | 410.34 g/mol |
| Exact Mass | 409.05 |
| IUPAC Name | N-[(5-bromothiophen-2-yl)methyl]-3-(carbamoylamino)-N-ethyl-3-phenylpropanamide |
| SMILES | CCN(Cc1ccc(Br)s1)C(=O)CC(NC(N)=O)c1ccccc1 |
| InChI | InChI=1S/C17H20BrN3O2S/c1-2-21(11-13-8-9-15(18)24-13)16(22)10-14(20-17(19)23)12-6-4-3-5-7-12/h3-9,14H,2,10-11H2,1H3,(H3,19,20,23) |
| InChIKey | KSIBVJURQLQJQW-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.34 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |