C12H19BrN2OS2 — CID 66218074
2-(3-aminopropylsulfanyl)-N-[(5-bromothiophen-2-yl)methyl]-N-ethylacetamide (PubChem CID 66218074) has the molecular formula C12H19BrN2OS2 and a molecular weight of 351.34 g/mol. Its IUPAC name is 2-(3-aminopropylsulfanyl)-N-[(5-bromothiophen-2-yl)methyl]-N-ethylacetamide.
| Compound Name | 2-(3-aminopropylsulfanyl)-N-[(5-bromothiophen-2-yl)methyl]-N-ethylacetamide |
|---|---|
| PubChem CID | 66218074 |
| Molecular Formula | C12H19BrN2OS2 |
| Molecular Weight | 351.34 g/mol |
| Exact Mass | 350.01 |
| IUPAC Name | 2-(3-aminopropylsulfanyl)-N-[(5-bromothiophen-2-yl)methyl]-N-ethylacetamide |
| SMILES | CCN(Cc1ccc(Br)s1)C(=O)CSCCCN |
| InChI | InChI=1S/C12H19BrN2OS2/c1-2-15(8-10-4-5-11(13)18-10)12(16)9-17-7-3-6-14/h4-5H,2-3,6-9,14H2,1H3 |
| InChIKey | VWWFBZNQYHIYSU-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.34 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|