C13H21BrN2OS2 — CID 66222934
2-(2-amino-2-methylpropyl)sulfanyl-N-[(5-bromothiophen-2-yl)methyl]-N-ethylacetamide (PubChem CID 66222934) has the molecular formula C13H21BrN2OS2 and a molecular weight of 365.36 g/mol. Its IUPAC name is 2-(2-amino-2-methylpropyl)sulfanyl-N-[(5-bromothiophen-2-yl)methyl]-N-ethylacetamide.
| Compound Name | 2-(2-amino-2-methylpropyl)sulfanyl-N-[(5-bromothiophen-2-yl)methyl]-N-ethylacetamide |
|---|---|
| PubChem CID | 66222934 |
| Molecular Formula | C13H21BrN2OS2 |
| Molecular Weight | 365.36 g/mol |
| Exact Mass | 364.03 |
| IUPAC Name | 2-(2-amino-2-methylpropyl)sulfanyl-N-[(5-bromothiophen-2-yl)methyl]-N-ethylacetamide |
| SMILES | CCN(Cc1ccc(Br)s1)C(=O)CSCC(C)(C)N |
| InChI | InChI=1S/C13H21BrN2OS2/c1-4-16(7-10-5-6-11(14)19-10)12(17)8-18-9-13(2,3)15/h5-6H,4,7-9,15H2,1-3H3 |
| InChIKey | SKKXUEVQXAUWPY-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.36 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |