C13H18BrNO3S2 — CID 66137813
3-[2-[(5-bromothiophen-2-yl)methyl-ethylamino]-2-oxoethyl]sulfanylbutanoic acid (PubChem CID 66137813) has the molecular formula C13H18BrNO3S2 and a molecular weight of 380.33 g/mol. Its IUPAC name is 3-[2-[(5-bromothiophen-2-yl)methyl-ethylamino]-2-oxoethyl]sulfanylbutanoic acid.
| Compound Name | 3-[2-[(5-bromothiophen-2-yl)methyl-ethylamino]-2-oxoethyl]sulfanylbutanoic acid |
|---|---|
| PubChem CID | 66137813 |
| Molecular Formula | C13H18BrNO3S2 |
| Molecular Weight | 380.33 g/mol |
| Exact Mass | 378.99 |
| IUPAC Name | 3-[2-[(5-bromothiophen-2-yl)methyl-ethylamino]-2-oxoethyl]sulfanylbutanoic acid |
| SMILES | CCN(Cc1ccc(Br)s1)C(=O)CSC(C)CC(=O)O |
| InChI | InChI=1S/C13H18BrNO3S2/c1-3-15(7-10-4-5-11(14)20-10)12(16)8-19-9(2)6-13(17)18/h4-5,9H,3,6-8H2,1-2H3,(H,17,18) |
| InChIKey | AUAPXASNWBXFKI-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.33 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |