C16H25BrN2OS — CID 104677775
2-[1-(aminomethyl)cyclohexyl]-N-[(5-bromothiophen-2-yl)methyl]-N-ethylacetamide (PubChem CID 104677775) has the molecular formula C16H25BrN2OS and a molecular weight of 373.36 g/mol. Its IUPAC name is 2-[1-(aminomethyl)cyclohexyl]-N-[(5-bromothiophen-2-yl)methyl]-N-ethylacetamide.
| Compound Name | 2-[1-(aminomethyl)cyclohexyl]-N-[(5-bromothiophen-2-yl)methyl]-N-ethylacetamide |
|---|---|
| PubChem CID | 104677775 |
| Molecular Formula | C16H25BrN2OS |
| Molecular Weight | 373.36 g/mol |
| Exact Mass | 372.09 |
| IUPAC Name | 2-[1-(aminomethyl)cyclohexyl]-N-[(5-bromothiophen-2-yl)methyl]-N-ethylacetamide |
| SMILES | CCN(Cc1ccc(Br)s1)C(=O)CC1(CN)CCCCC1 |
| InChI | InChI=1S/C16H25BrN2OS/c1-2-19(11-13-6-7-14(17)21-13)15(20)10-16(12-18)8-4-3-5-9-16/h6-7H,2-5,8-12,18H2,1H3 |
| InChIKey | MVXYDSSITWWLSP-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.36 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |