C18H19NO2S — CID 76858086
N-(4-methoxyphenyl)-N-(thiophen-2-ylmethyl)hexa-2,4-dienamide (PubChem CID 76858086) has the molecular formula C18H19NO2S and a molecular weight of 313.42 g/mol. Its IUPAC name is N-(4-methoxyphenyl)-N-(thiophen-2-ylmethyl)hexa-2,4-dienamide.
| Compound Name | N-(4-methoxyphenyl)-N-(thiophen-2-ylmethyl)hexa-2,4-dienamide |
|---|---|
| PubChem CID | 76858086 |
| Molecular Formula | C18H19NO2S |
| Molecular Weight | 313.42 g/mol |
| Exact Mass | 313.11 |
| IUPAC Name | N-(4-methoxyphenyl)-N-(thiophen-2-ylmethyl)hexa-2,4-dienamide |
| SMILES | CC=CC=CC(=O)N(Cc1cccs1)c1ccc(OC)cc1 |
| InChI | InChI=1S/C18H19NO2S/c1-3-4-5-8-18(20)19(14-17-7-6-13-22-17)15-9-11-16(21-2)12-10-15/h3-13H,14H2,1-2H3 |
| InChIKey | RAEORUPPUJZMFD-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.42 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|