C21H21NO3S2 — CID 35041458
N-(4-methoxyphenyl)-2-(3-methoxyphenyl)sulfanyl-N-(thiophen-2-ylmethyl)acetamide (PubChem CID 35041458) has the molecular formula C21H21NO3S2 and a molecular weight of 399.54 g/mol. Its IUPAC name is N-(4-methoxyphenyl)-2-(3-methoxyphenyl)sulfanyl-N-(thiophen-2-ylmethyl)acetamide.
| Compound Name | N-(4-methoxyphenyl)-2-(3-methoxyphenyl)sulfanyl-N-(thiophen-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 35041458 |
| Molecular Formula | C21H21NO3S2 |
| Molecular Weight | 399.54 g/mol |
| Exact Mass | 399.10 |
| IUPAC Name | N-(4-methoxyphenyl)-2-(3-methoxyphenyl)sulfanyl-N-(thiophen-2-ylmethyl)acetamide |
| SMILES | COc1ccc(N(Cc2cccs2)C(=O)CSc2cccc(OC)c2)cc1 |
| InChI | InChI=1S/C21H21NO3S2/c1-24-17-10-8-16(9-11-17)22(14-20-7-4-12-26-20)21(23)15-27-19-6-3-5-18(13-19)25-2/h3-13H,14-15H2,1-2H3 |
| InChIKey | VTWKANSHVBXKLV-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.54 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |