C19H22N2O2S3 — CID 9347668
[2-[4-methoxy-N-(thiophen-2-ylmethyl)anilino]-2-oxoethyl] pyrrolidine-1-carbodithioate (PubChem CID 9347668) has the molecular formula C19H22N2O2S3 and a molecular weight of 406.60 g/mol. Its IUPAC name is [2-[4-methoxy-N-(thiophen-2-ylmethyl)anilino]-2-oxoethyl] pyrrolidine-1-carbodithioate.
| Compound Name | [2-[4-methoxy-N-(thiophen-2-ylmethyl)anilino]-2-oxoethyl] pyrrolidine-1-carbodithioate |
|---|---|
| PubChem CID | 9347668 |
| Molecular Formula | C19H22N2O2S3 |
| Molecular Weight | 406.60 g/mol |
| Exact Mass | 406.08 |
| IUPAC Name | [2-[4-methoxy-N-(thiophen-2-ylmethyl)anilino]-2-oxoethyl] pyrrolidine-1-carbodithioate |
| SMILES | COc1ccc(N(Cc2cccs2)C(=O)CSC(=S)N2CCCC2)cc1 |
| InChI | InChI=1S/C19H22N2O2S3/c1-23-16-8-6-15(7-9-16)21(13-17-5-4-12-25-17)18(22)14-26-19(24)20-10-2-3-11-20/h4-9,12H,2-3,10-11,13-14H2,1H3 |
| InChIKey | QVRUKWIDMZDUMD-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.60 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|