C13H18N2OS3 — CID 78765929
[2-[methyl(thiophen-2-ylmethyl)amino]-2-oxoethyl] pyrrolidine-1-carbodithioate (PubChem CID 78765929) has the molecular formula C13H18N2OS3 and a molecular weight of 314.50 g/mol. Its IUPAC name is [2-[methyl(thiophen-2-ylmethyl)amino]-2-oxoethyl] pyrrolidine-1-carbodithioate.
| Compound Name | [2-[methyl(thiophen-2-ylmethyl)amino]-2-oxoethyl] pyrrolidine-1-carbodithioate |
|---|---|
| PubChem CID | 78765929 |
| Molecular Formula | C13H18N2OS3 |
| Molecular Weight | 314.50 g/mol |
| Exact Mass | 314.06 |
| IUPAC Name | [2-[methyl(thiophen-2-ylmethyl)amino]-2-oxoethyl] pyrrolidine-1-carbodithioate |
| SMILES | CN(Cc1cccs1)C(=O)CSC(=S)N1CCCC1 |
| InChI | InChI=1S/C13H18N2OS3/c1-14(9-11-5-4-8-18-11)12(16)10-19-13(17)15-6-2-3-7-15/h4-5,8H,2-3,6-7,9-10H2,1H3 |
| InChIKey | SKXGOGRKQIEIOX-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.50 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|