C20H22N2OS2 — CID 56735144
[2-oxo-2-(N-phenylanilino)ethyl] piperidine-1-carbodithioate (PubChem CID 56735144) has the molecular formula C20H22N2OS2 and a molecular weight of 370.54 g/mol. Its IUPAC name is [2-oxo-2-(N-phenylanilino)ethyl] piperidine-1-carbodithioate.
| Compound Name | [2-oxo-2-(N-phenylanilino)ethyl] piperidine-1-carbodithioate |
|---|---|
| PubChem CID | 56735144 |
| Molecular Formula | C20H22N2OS2 |
| Molecular Weight | 370.54 g/mol |
| Exact Mass | 370.12 |
| IUPAC Name | [2-oxo-2-(N-phenylanilino)ethyl] piperidine-1-carbodithioate |
| SMILES | O=C(CSC(=S)N1CCCCC1)N(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H22N2OS2/c23-19(16-25-20(24)21-14-8-3-9-15-21)22(17-10-4-1-5-11-17)18-12-6-2-7-13-18/h1-2,4-7,10-13H,3,8-9,14-16H2 |
| InChIKey | IQHFVIUNGSFIEQ-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.54 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|