C13H15NO2S2 — CID 44726089
[2-(2-hydroxyphenyl)-2-oxoethyl] pyrrolidine-1-carbodithioate (PubChem CID 44726089) has the molecular formula C13H15NO2S2 and a molecular weight of 281.40 g/mol. Its IUPAC name is [2-(2-hydroxyphenyl)-2-oxoethyl] pyrrolidine-1-carbodithioate.
| Compound Name | [2-(2-hydroxyphenyl)-2-oxoethyl] pyrrolidine-1-carbodithioate |
|---|---|
| PubChem CID | 44726089 |
| Molecular Formula | C13H15NO2S2 |
| Molecular Weight | 281.40 g/mol |
| Exact Mass | 281.05 |
| IUPAC Name | [2-(2-hydroxyphenyl)-2-oxoethyl] pyrrolidine-1-carbodithioate |
| SMILES | O=C(CSC(=S)N1CCCC1)c1ccccc1O |
| InChI | InChI=1S/C13H15NO2S2/c15-11-6-2-1-5-10(11)12(16)9-18-13(17)14-7-3-4-8-14/h1-2,5-6,15H,3-4,7-9H2 |
| InChIKey | OLWNBTZGIDVTHF-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.40 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|