C17H23NOS2 — CID 134066166
[2-(2,5-dimethylphenyl)-2-oxoethyl] azepane-1-carbodithioate (PubChem CID 134066166) has the molecular formula C17H23NOS2 and a molecular weight of 321.51 g/mol. Its IUPAC name is [2-(2,5-dimethylphenyl)-2-oxoethyl] azepane-1-carbodithioate.
| Compound Name | [2-(2,5-dimethylphenyl)-2-oxoethyl] azepane-1-carbodithioate |
|---|---|
| PubChem CID | 134066166 |
| Molecular Formula | C17H23NOS2 |
| Molecular Weight | 321.51 g/mol |
| Exact Mass | 321.12 |
| IUPAC Name | [2-(2,5-dimethylphenyl)-2-oxoethyl] azepane-1-carbodithioate |
| SMILES | Cc1ccc(C)c(C(=O)CSC(=S)N2CCCCCC2)c1 |
| InChI | InChI=1S/C17H23NOS2/c1-13-7-8-14(2)15(11-13)16(19)12-21-17(20)18-9-5-3-4-6-10-18/h7-8,11H,3-6,9-10,12H2,1-2H3 |
| InChIKey | BMFGQMGSCNXLGS-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.51 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|