C24H27NOS2 — CID 132605171
[2-oxo-2-(5-tricyclo[8.2.2.24,7]hexadeca-1(13),4,6,10(14),11,15-hexaenyl)ethyl] piperidine-1-carbodithioate (PubChem CID 132605171) has the molecular formula C24H27NOS2 and a molecular weight of 409.62 g/mol. Its IUPAC name is [2-oxo-2-(5-tricyclo[8.2.2.24,7]hexadeca-1(13),4,6,10(14),11,15-hexaenyl)ethyl] piperidine-1-carbodithioate.
| Compound Name | [2-oxo-2-(5-tricyclo[8.2.2.24,7]hexadeca-1(13),4,6,10(14),11,15-hexaenyl)ethyl] piperidine-1-carbodithioate |
|---|---|
| PubChem CID | 132605171 |
| Molecular Formula | C24H27NOS2 |
| Molecular Weight | 409.62 g/mol |
| Exact Mass | 409.15 |
| IUPAC Name | [2-oxo-2-(5-tricyclo[8.2.2.24,7]hexadeca-1(13),4,6,10(14),11,15-hexaenyl)ethyl] piperidine-1-carbodithioate |
| SMILES | O=C(CSC(=S)N1CCCCC1)c1cc2ccc1CCc1ccc(cc1)CC2 |
| InChI | InChI=1S/C24H27NOS2/c26-23(17-28-24(27)25-14-2-1-3-15-25)22-16-20-9-8-18-4-6-19(7-5-18)10-12-21(22)13-11-20/h4-7,11,13,16H,1-3,8-10,12,14-15,17H2 |
| InChIKey | BJACHBCKXKVFFR-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.62 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|