C14H15I2NO2S2 — CID 11763328
[2-(2-hydroxy-3,5-diiodophenyl)-2-oxoethyl] piperidine-1-carbodithioate (PubChem CID 11763328) has the molecular formula C14H15I2NO2S2 and a molecular weight of 547.22 g/mol. Its IUPAC name is [2-(2-hydroxy-3,5-diiodophenyl)-2-oxoethyl] piperidine-1-carbodithioate.
| Compound Name | [2-(2-hydroxy-3,5-diiodophenyl)-2-oxoethyl] piperidine-1-carbodithioate |
|---|---|
| PubChem CID | 11763328 |
| Molecular Formula | C14H15I2NO2S2 |
| Molecular Weight | 547.22 g/mol |
| Exact Mass | 546.86 |
| IUPAC Name | [2-(2-hydroxy-3,5-diiodophenyl)-2-oxoethyl] piperidine-1-carbodithioate |
| SMILES | O=C(CSC(=S)N1CCCCC1)c1cc(I)cc(I)c1O |
| InChI | InChI=1S/C14H15I2NO2S2/c15-9-6-10(13(19)11(16)7-9)12(18)8-21-14(20)17-4-2-1-3-5-17/h6-7,19H,1-5,8H2 |
| InChIKey | KPMNYCIJFGLGFL-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.22 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|