C24H33N3S9 — CID 54513679
[3,5-bis(piperidine-1-carbothioyldisulfanyl)phenyl]sulfanyl piperidine-1-carbodithioate (PubChem CID 54513679) has the molecular formula C24H33N3S9 and a molecular weight of 652.15 g/mol. Its IUPAC name is [3,5-bis(piperidine-1-carbothioyldisulfanyl)phenyl]sulfanyl piperidine-1-carbodithioate.
| Compound Name | [3,5-bis(piperidine-1-carbothioyldisulfanyl)phenyl]sulfanyl piperidine-1-carbodithioate |
|---|---|
| PubChem CID | 54513679 |
| Molecular Formula | C24H33N3S9 |
| Molecular Weight | 652.15 g/mol |
| Exact Mass | 651.02 |
| IUPAC Name | [3,5-bis(piperidine-1-carbothioyldisulfanyl)phenyl]sulfanyl piperidine-1-carbodithioate |
| SMILES | S=C(SSc1cc(SSC(=S)N2CCCCC2)cc(SSC(=S)N2CCCCC2)c1)N1CCCCC1 |
| InChI | InChI=1S/C24H33N3S9/c28-22(25-10-4-1-5-11-25)34-31-19-16-20(32-35-23(29)26-12-6-2-7-13-26)18-21(17-19)33-36-24(30)27-14-8-3-9-15-27/h16-18H,1-15H2 |
| InChIKey | YKXCQIKHQLWKBE-UHFFFAOYSA-N |
| XLogP | 9.22 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.15 |
| LogP ≤ 5 | 9.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|