About [(E)-4-(azepane-1-carbothioyldisulfanyl)but-2-enyl]sulfanyl azepane-1-carbodithioate
[(E)-4-(azepane-1-carbothioyldisulfanyl)but-2-enyl]sulfanyl azepane-1-carbodithioate (PubChem CID 87611237) has the molecular formula C18H30N2S6
and a molecular weight of 466.85 g/mol. Its IUPAC name is [(E)-4-(azepane-1-carbothioyldisulfanyl)but-2-enyl]sulfanyl azepane-1-carbodithioate.
Molecular Properties
| Compound Name | [(E)-4-(azepane-1-carbothioyldisulfanyl)but-2-enyl]sulfanyl azepane-1-carbodithioate |
| PubChem CID | 87611237 |
| Molecular Formula | C18H30N2S6 |
| Molecular Weight | 466.85 g/mol |
| Exact Mass | 466.07 |
| IUPAC Name | [(E)-4-(azepane-1-carbothioyldisulfanyl)but-2-enyl]sulfanyl azepane-1-carbodithioate |
| SMILES | S=C(SSC/C=C/CSSC(=S)N1CCCCCC1)N1CCCCCC1 |
| InChI | InChI=1S/C18H30N2S6/c21-17(19-11-5-1-2-6-12-19)25-23-15-9-10-16-24-26-18(22)20-13-7-3-4-8-14-20/h9-10H,1-8,11-16H2/b10-9+ |
| InChIKey | ZZQFCEOCTKBVBH-MDZDMXLPSA-N |
| XLogP | 6.63 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 466.85 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze [(E)-4-(azepane-1-carbothioyldisulfanyl)but-2-enyl]sulfanyl azepane-1-carbodithioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-4-(azepane-1-carbothioyldisulfanyl)but-2-enyl]sulfanyl azepane-1-carbodithioate?
The IUPAC name of [(E)-4-(azepane-1-carbothioyldisulfanyl)but-2-enyl]sulfanyl azepane-1-carbodithioate (CID 87611237) is [(E)-4-(azepane-1-carbothioyldisulfanyl)but-2-enyl]sulfanyl azepane-1-carbodithioate.
What is the SMILES notation for [(E)-4-(azepane-1-carbothioyldisulfanyl)but-2-enyl]sulfanyl azepane-1-carbodithioate?
The canonical SMILES for [(E)-4-(azepane-1-carbothioyldisulfanyl)but-2-enyl]sulfanyl azepane-1-carbodithioate is S=C(SSC/C=C/CSSC(=S)N1CCCCCC1)N1CCCCCC1.
What is the InChIKey of [(E)-4-(azepane-1-carbothioyldisulfanyl)but-2-enyl]sulfanyl azepane-1-carbodithioate?
The InChIKey is ZZQFCEOCTKBVBH-MDZDMXLPSA-N. The full InChI is InChI=1S/C18H30N2S6/c21-17(19-11-5-1-2-6-12-19)25-23-15-9-10-16-24-26-18(22)20-13-7-3-4-8-14-20/h9-10H,1-8,11-16H2/b10-9+.
What are the key properties of [(E)-4-(azepane-1-carbothioyldisulfanyl)but-2-enyl]sulfanyl azepane-1-carbodithioate?
[(E)-4-(azepane-1-carbothioyldisulfanyl)but-2-enyl]sulfanyl azepane-1-carbodithioate has a molecular weight of 466.85 g/mol, XLogP of 6.63, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-4-(azepane-1-carbothioyldisulfanyl)but-2-enyl]sulfanyl azepane-1-carbodithioate is sourced from PubChem (CID 87611237), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).