C11H17NS2 — CID 13095313
[(2E,4E)-hexa-2,4-dienyl] pyrrolidine-1-carbodithioate (PubChem CID 13095313) has the molecular formula C11H17NS2 and a molecular weight of 227.40 g/mol. Its IUPAC name is [(2E,4E)-hexa-2,4-dienyl] pyrrolidine-1-carbodithioate.
| Compound Name | [(2E,4E)-hexa-2,4-dienyl] pyrrolidine-1-carbodithioate |
|---|---|
| PubChem CID | 13095313 |
| Molecular Formula | C11H17NS2 |
| Molecular Weight | 227.40 g/mol |
| Exact Mass | 227.08 |
| IUPAC Name | [(2E,4E)-hexa-2,4-dienyl] pyrrolidine-1-carbodithioate |
| SMILES | C/C=C/C=C/CSC(=S)N1CCCC1 |
| InChI | InChI=1S/C11H17NS2/c1-2-3-4-7-10-14-11(13)12-8-5-6-9-12/h2-4,7H,5-6,8-10H2,1H3/b3-2+,7-4+ |
| InChIKey | QNQGCGLBHNQUKY-AOGGBPEJSA-N |
| XLogP | 3.23 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.40 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|