About CID 140773790
CID 140773790 (PubChem CID 140773790) has the molecular formula C7H12NS2
and a molecular weight of 174.31 g/mol.
Molecular Properties
| Compound Name | CID 140773790 |
| PubChem CID | 140773790 |
| Molecular Formula | C7H12NS2 |
| Molecular Weight | 174.31 g/mol |
| Exact Mass | 174.04 |
| IUPAC Name | — |
| SMILES | [CH2]SC(=S)N1CCCCC1 |
| InChI | InChI=1S/C7H12NS2/c1-10-7(9)8-5-3-2-4-6-8/h1-6H2 |
| InChIKey | HRTIULUSMRTPNL-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.31 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze CID 140773790 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 140773790?
The IUPAC name of CID 140773790 (CID 140773790) is not available.
What is the SMILES notation for CID 140773790?
The canonical SMILES for CID 140773790 is [CH2]SC(=S)N1CCCCC1.
What is the InChIKey of CID 140773790?
The InChIKey is HRTIULUSMRTPNL-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12NS2/c1-10-7(9)8-5-3-2-4-6-8/h1-6H2.
What are the key properties of CID 140773790?
CID 140773790 has a molecular weight of 174.31 g/mol, XLogP of 2.28, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 140773790 is sourced from PubChem (CID 140773790), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).