About 2-hydroxyethylsulfanyl pyrrolidine-1-carbodithioate
2-hydroxyethylsulfanyl pyrrolidine-1-carbodithioate (PubChem CID 122384090) has the molecular formula C7H13NOS3
and a molecular weight of 223.39 g/mol. Its IUPAC name is 2-hydroxyethylsulfanyl pyrrolidine-1-carbodithioate.
Molecular Properties
| Compound Name | 2-hydroxyethylsulfanyl pyrrolidine-1-carbodithioate |
| PubChem CID | 122384090 |
| Molecular Formula | C7H13NOS3 |
| Molecular Weight | 223.39 g/mol |
| Exact Mass | 223.02 |
| IUPAC Name | 2-hydroxyethylsulfanyl pyrrolidine-1-carbodithioate |
| SMILES | OCCSSC(=S)N1CCCC1 |
| InChI | InChI=1S/C7H13NOS3/c9-5-6-11-12-7(10)8-3-1-2-4-8/h9H,1-6H2 |
| InChIKey | QNDBMHUQDUBUPK-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.39 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2-hydroxyethylsulfanyl pyrrolidine-1-carbodithioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxyethylsulfanyl pyrrolidine-1-carbodithioate?
The IUPAC name of 2-hydroxyethylsulfanyl pyrrolidine-1-carbodithioate (CID 122384090) is 2-hydroxyethylsulfanyl pyrrolidine-1-carbodithioate.
What is the SMILES notation for 2-hydroxyethylsulfanyl pyrrolidine-1-carbodithioate?
The canonical SMILES for 2-hydroxyethylsulfanyl pyrrolidine-1-carbodithioate is OCCSSC(=S)N1CCCC1.
What is the InChIKey of 2-hydroxyethylsulfanyl pyrrolidine-1-carbodithioate?
The InChIKey is QNDBMHUQDUBUPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13NOS3/c9-5-6-11-12-7(10)8-3-1-2-4-8/h9H,1-6H2.
What are the key properties of 2-hydroxyethylsulfanyl pyrrolidine-1-carbodithioate?
2-hydroxyethylsulfanyl pyrrolidine-1-carbodithioate has a molecular weight of 223.39 g/mol, XLogP of 1.74, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxyethylsulfanyl pyrrolidine-1-carbodithioate is sourced from PubChem (CID 122384090), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).