C14H17I2NO3 — CID 63402925
(2-hydroxy-3,5-diiodophenyl)-[2-(2-hydroxyethyl)piperidin-1-yl]methanone (PubChem CID 63402925) has the molecular formula C14H17I2NO3 and a molecular weight of 501.10 g/mol. Its IUPAC name is (2-hydroxy-3,5-diiodophenyl)-[2-(2-hydroxyethyl)piperidin-1-yl]methanone.
| Compound Name | (2-hydroxy-3,5-diiodophenyl)-[2-(2-hydroxyethyl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 63402925 |
| Molecular Formula | C14H17I2NO3 |
| Molecular Weight | 501.10 g/mol |
| Exact Mass | 500.93 |
| IUPAC Name | (2-hydroxy-3,5-diiodophenyl)-[2-(2-hydroxyethyl)piperidin-1-yl]methanone |
| SMILES | O=C(c1cc(I)cc(I)c1O)N1CCCCC1CCO |
| InChI | InChI=1S/C14H17I2NO3/c15-9-7-11(13(19)12(16)8-9)14(20)17-5-2-1-3-10(17)4-6-18/h7-8,10,18-19H,1-6H2 |
| InChIKey | VKOOBZLGVQJZRW-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.10 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|